3-Methylheptane
3-Methylheptane is a branched alkane isomeric to octane. Its structural formula is CH3CH2CH(CH3)CH2CH2CH2CH3. It has one stereocenter.
![]()  | |
![]()  | |
| Names | |
|---|---|
| Preferred IUPAC name
 3-Methylheptane[1]  | |
| Identifiers | |
3D model (JSmol)  | 
|
| 1730777 | |
| ChemSpider | |
| ECHA InfoCard | 100.008.783 | 
| EC Number | 
  | 
PubChem CID  | 
|
| UNII | |
| UN number | 1262 | 
CompTox Dashboard (EPA)  | 
|
  | |
  | |
| Properties | |
| C8H18 | |
| Molar mass | 114.232 g·mol−1 | 
| Appearance | Colourless liquid | 
| Odor | Odourless | 
| Density | 705 mg mL−1 | 
| Melting point | −122 to −120 °C; −188 to −184 °F; 151 to 153 K | 
| Boiling point | 118 to 120 °C; 244 to 248 °F; 391 to 393 K | 
| Vapor pressure | 5.0 kPa (at 37.7 °C) | 
Henry's law constant (kH)  | 
2.7 nmol Pa−1 kg−1 | 
| -97.99·10−6 cm3/mol | |
Refractive index (nD)  | 
1.398–1.399 | 
| Thermochemistry | |
Heat capacity (C)  | 
250.20 J K−1 mol−1 | 
Std molar entropy (S  | 
362.6 J K−1 mol−1 | 
Std enthalpy of formation (ΔfH⦵298)  | 
−253.6–−251.4 kJ mol−1 | 
Std enthalpy of combustion (ΔcH⦵298)  | 
−5469.5–−5466.9 kJ mol−1 | 
| Hazards | |
| GHS labelling: | |
      ![]()  | |
| Danger | |
| H225, H304, H315, H336, H410 | |
| P210, P261, P273, P301+P310, P331 | |
| Flash point | 7.2 °C (45.0 °F; 280.3 K) | 
| Explosive limits | 0.98–?% | 
| Related compounds | |
Related alkanes  | 
|
Related compounds  | 
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). 
Infobox references  | |
Its refractive index is 1.398 (20 °C, D).
References
    
- "3-METHYLHEPTANE - Compound Summary". PubChem Compound. USA: National Center for Biotechnology Information. 26 March 2005. Identification and Related Records. Retrieved 8 March 2012.
 
    This article is issued from Wikipedia. The text is licensed under Creative Commons - Attribution - Sharealike. Additional terms may apply for the media files.





